C8H7F3S — CID 167238139
(4-ethyl-2,3-difluorophenyl) thiohypofluorite (PubChem CID 167238139) has the molecular formula C8H7F3S and a molecular weight of 192.21 g/mol. Its IUPAC name is (4-ethyl-2,3-difluorophenyl) thiohypofluorite.
| Compound Name | (4-ethyl-2,3-difluorophenyl) thiohypofluorite |
|---|---|
| PubChem CID | 167238139 |
| Molecular Formula | C8H7F3S |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | (4-ethyl-2,3-difluorophenyl) thiohypofluorite |
| SMILES | CCc1ccc(SF)c(F)c1F |
| InChI | InChI=1S/C8H7F3S/c1-2-5-3-4-6(12-11)8(10)7(5)9/h3-4H,2H2,1H3 |
| InChIKey | FLSRTZUFDFFKMR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |