C10H14NOPS — CID 167252984
4-dicyclopropylphosphoryl-2-methyl-1,3-thiazole (PubChem CID 167252984) has the molecular formula C10H14NOPS and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-dicyclopropylphosphoryl-2-methyl-1,3-thiazole.
| Compound Name | 4-dicyclopropylphosphoryl-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 167252984 |
| Molecular Formula | C10H14NOPS |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 4-dicyclopropylphosphoryl-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(P(=O)(C2CC2)C2CC2)cs1 |
| InChI | InChI=1S/C10H14NOPS/c1-7-11-10(6-14-7)13(12,8-2-3-8)9-4-5-9/h6,8-9H,2-5H2,1H3 |
| InChIKey | DHTUYAZDSRIFKW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|