C13H27N — CID 167253658
3-tert-butyl-1-(2,3-dimethylbutyl)azetidine (PubChem CID 167253658) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is 3-tert-butyl-1-(2,3-dimethylbutyl)azetidine.
| Compound Name | 3-tert-butyl-1-(2,3-dimethylbutyl)azetidine |
|---|---|
| PubChem CID | 167253658 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 3-tert-butyl-1-(2,3-dimethylbutyl)azetidine |
| SMILES | CC(C)C(C)CN1CC(C(C)(C)C)C1 |
| InChI | InChI=1S/C13H27N/c1-10(2)11(3)7-14-8-12(9-14)13(4,5)6/h10-12H,7-9H2,1-6H3 |
| InChIKey | UGDQBOGUUWWAMN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |