C20H25ClF2N2O2S2 — CID 167253902
2-[4-chloro-3,5-difluoro-2,6-di(propan-2-yl)phenyl]-N-[[5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]sulfanyl]acetamide (PubChem CID 167253902) has the molecular formula C20H25ClF2N2O2S2 and a molecular weight of 463.02 g/mol. Its IUPAC name is 2-[4-chloro-3,5-difluoro-2,6-di(propan-2-yl)phenyl]-N-[[5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]sulfanyl]acetamide.
| Compound Name | 2-[4-chloro-3,5-difluoro-2,6-di(propan-2-yl)phenyl]-N-[[5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 167253902 |
| Molecular Formula | C20H25ClF2N2O2S2 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2-[4-chloro-3,5-difluoro-2,6-di(propan-2-yl)phenyl]-N-[[5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
| SMILES | CC(C)c1c(F)c(Cl)c(F)c(C(C)C)c1CC(=O)NSc1ncc(C(C)(C)O)s1 |
| InChI | InChI=1S/C20H25ClF2N2O2S2/c1-9(2)14-11(15(10(3)4)18(23)16(21)17(14)22)7-13(26)25-29-19-24-8-12(28-19)20(5,6)27/h8-10,27H,7H2,1-6H3,(H,25,26) |
| InChIKey | UWXJNWLFDSZTOV-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|