C24H24FN7O2 — CID 167255822
2-[(7-fluoroquinazolin-6-yl)amino]-9-(3-hydroxy-1-adamantyl)-7-methylpurin-8-one (PubChem CID 167255822) has the molecular formula C24H24FN7O2 and a molecular weight of 461.50 g/mol. Its IUPAC name is 2-[(7-fluoroquinazolin-6-yl)amino]-9-(3-hydroxy-1-adamantyl)-7-methylpurin-8-one.
| Compound Name | 2-[(7-fluoroquinazolin-6-yl)amino]-9-(3-hydroxy-1-adamantyl)-7-methylpurin-8-one |
|---|---|
| PubChem CID | 167255822 |
| Molecular Formula | C24H24FN7O2 |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 2-[(7-fluoroquinazolin-6-yl)amino]-9-(3-hydroxy-1-adamantyl)-7-methylpurin-8-one |
| SMILES | Cn1c(=O)n(C23CC4CC(CC(O)(C4)C2)C3)c2nc(Nc3cc4cncnc4cc3F)ncc21 |
| InChI | InChI=1S/C24H24FN7O2/c1-31-19-10-27-21(29-18-3-15-9-26-12-28-17(15)4-16(18)25)30-20(19)32(22(31)33)23-5-13-2-14(6-23)8-24(34,7-13)11-23/h3-4,9-10,12-14,34H,2,5-8,11H2,1H3,(H,27,29,30) |
| InChIKey | IEBLIRMRHXOEBI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |