C24H26N6O2 — CID 166504003
9-(5-hydroxy-2-adamantyl)-2-(4-isocyano-2-methylanilino)-7-methylpurin-8-one (PubChem CID 166504003) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 9-(5-hydroxy-2-adamantyl)-2-(4-isocyano-2-methylanilino)-7-methylpurin-8-one.
| Compound Name | 9-(5-hydroxy-2-adamantyl)-2-(4-isocyano-2-methylanilino)-7-methylpurin-8-one |
|---|---|
| PubChem CID | 166504003 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 9-(5-hydroxy-2-adamantyl)-2-(4-isocyano-2-methylanilino)-7-methylpurin-8-one |
| SMILES | [C-]#[N+]c1ccc(Nc2ncc3c(n2)n(C2C4CC5CC2CC(O)(C5)C4)c(=O)n3C)c(C)c1 |
| InChI | InChI=1S/C24H26N6O2/c1-13-6-17(25-2)4-5-18(13)27-22-26-12-19-21(28-22)30(23(31)29(19)3)20-15-7-14-8-16(20)11-24(32,9-14)10-15/h4-6,12,14-16,20,32H,7-11H2,1,3H3,(H,26,27,28) |
| InChIKey | XUXBTTLLMXAKJW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|