C24H24N4O2 — CID 167261803
3-[4-(3-but-3-ynyldiaziridin-3-yl)-2-oxobutyl]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 167261803) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-[4-(3-but-3-ynyldiaziridin-3-yl)-2-oxobutyl]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 3-[4-(3-but-3-ynyldiaziridin-3-yl)-2-oxobutyl]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 167261803 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 3-[4-(3-but-3-ynyldiaziridin-3-yl)-2-oxobutyl]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | C#CCCC1(CCC(=O)CC2N=C(c3ccccc3)c3ccccc3NC2=O)NN1 |
| InChI | InChI=1S/C24H24N4O2/c1-2-3-14-24(27-28-24)15-13-18(29)16-21-23(30)26-20-12-8-7-11-19(20)22(25-21)17-9-5-4-6-10-17/h1,4-12,21,27-28H,3,13-16H2,(H,26,30) |
| InChIKey | MVBWBZIINGEJFZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|