C15H25N3O5S — CID 167263521
2-[3-(carbamothioylamino)-3-oxopropoxy]ethyl 5-(2-methylprop-2-enoylamino)pentanoate (PubChem CID 167263521) has the molecular formula C15H25N3O5S and a molecular weight of 359.45 g/mol. Its IUPAC name is 2-[3-(carbamothioylamino)-3-oxopropoxy]ethyl 5-(2-methylprop-2-enoylamino)pentanoate.
| Compound Name | 2-[3-(carbamothioylamino)-3-oxopropoxy]ethyl 5-(2-methylprop-2-enoylamino)pentanoate |
|---|---|
| PubChem CID | 167263521 |
| Molecular Formula | C15H25N3O5S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-[3-(carbamothioylamino)-3-oxopropoxy]ethyl 5-(2-methylprop-2-enoylamino)pentanoate |
| SMILES | C=C(C)C(=O)NCCCCC(=O)OCCOCCC(=O)NC(N)=S |
| InChI | InChI=1S/C15H25N3O5S/c1-11(2)14(21)17-7-4-3-5-13(20)23-10-9-22-8-6-12(19)18-15(16)24/h1,3-10H2,2H3,(H,17,21)(H3,16,18,19,24) |
| InChIKey | MHYYTODMNIXWML-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|