C18H24O3 — CID 16726706
(1S,3S,5S,9R)-3-ethenyl-13-(methoxymethoxy)tricyclo[7.4.1.01,5]tetradeca-6,11-dien-14-one (PubChem CID 16726706) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (1S,3S,5S,9R)-3-ethenyl-13-(methoxymethoxy)tricyclo[7.4.1.01,5]tetradeca-6,11-dien-14-one.
| Compound Name | (1S,3S,5S,9R)-3-ethenyl-13-(methoxymethoxy)tricyclo[7.4.1.01,5]tetradeca-6,11-dien-14-one |
|---|---|
| PubChem CID | 16726706 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (1S,3S,5S,9R)-3-ethenyl-13-(methoxymethoxy)tricyclo[7.4.1.01,5]tetradeca-6,11-dien-14-one |
| SMILES | C=C[C@H]1C[C@H]2C=CC[C@@H]3CC=CC(OCOC)[C@@]2(C1)C3=O |
| InChI | InChI=1S/C18H24O3/c1-3-13-10-15-8-4-6-14-7-5-9-16(21-12-20-2)18(15,11-13)17(14)19/h3-5,8-9,13-16H,1,6-7,10-12H2,2H3/t13-,14+,15+,16?,18-/m0/s1 |
| InChIKey | MDMJVCZGHOBAAT-RKPARWBMSA-N |
| XLogP | 3.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|