About dimethoxyphosphoryl [methoxy(propan-2-yl)phosphoryl] methyl phosphate
dimethoxyphosphoryl [methoxy(propan-2-yl)phosphoryl] methyl phosphate (PubChem CID 167268096) has the molecular formula C7H19O9P3
and a molecular weight of 340.14 g/mol. Its IUPAC name is dimethoxyphosphoryl [methoxy(propan-2-yl)phosphoryl] methyl phosphate.
Molecular Properties
| Compound Name | dimethoxyphosphoryl [methoxy(propan-2-yl)phosphoryl] methyl phosphate |
| PubChem CID | 167268096 |
| Molecular Formula | C7H19O9P3 |
| Molecular Weight | 340.14 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | dimethoxyphosphoryl [methoxy(propan-2-yl)phosphoryl] methyl phosphate |
| SMILES | COP(=O)(OC)OP(=O)(OC)OP(=O)(OC)C(C)C |
| InChI | InChI=1S/C7H19O9P3/c1-7(2)17(8,11-3)15-19(10,14-6)16-18(9,12-4)13-5/h7H,1-6H3 |
| InChIKey | QGNHDUHSIZFPSM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.14 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethoxyphosphoryl [methoxy(propan-2-yl)phosphoryl] methyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxyphosphoryl [methoxy(propan-2-yl)phosphoryl] methyl phosphate?
The IUPAC name of dimethoxyphosphoryl [methoxy(propan-2-yl)phosphoryl] methyl phosphate (CID 167268096) is dimethoxyphosphoryl [methoxy(propan-2-yl)phosphoryl] methyl phosphate.
What is the SMILES notation for dimethoxyphosphoryl [methoxy(propan-2-yl)phosphoryl] methyl phosphate?
The canonical SMILES for dimethoxyphosphoryl [methoxy(propan-2-yl)phosphoryl] methyl phosphate is COP(=O)(OC)OP(=O)(OC)OP(=O)(OC)C(C)C.
What is the InChIKey of dimethoxyphosphoryl [methoxy(propan-2-yl)phosphoryl] methyl phosphate?
The InChIKey is QGNHDUHSIZFPSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H19O9P3/c1-7(2)17(8,11-3)15-19(10,14-6)16-18(9,12-4)13-5/h7H,1-6H3.
What are the key properties of dimethoxyphosphoryl [methoxy(propan-2-yl)phosphoryl] methyl phosphate?
dimethoxyphosphoryl [methoxy(propan-2-yl)phosphoryl] methyl phosphate has a molecular weight of 340.14 g/mol, XLogP of 3.42, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxyphosphoryl [methoxy(propan-2-yl)phosphoryl] methyl phosphate is sourced from PubChem (CID 167268096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).