C26H25F4NO2 — CID 167269615
(2-methyl-2-adamantyl) 4-(4-ethenyl-2,3,5,6-tetrafluoroanilino)benzoate (PubChem CID 167269615) has the molecular formula C26H25F4NO2 and a molecular weight of 459.48 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 4-(4-ethenyl-2,3,5,6-tetrafluoroanilino)benzoate.
| Compound Name | (2-methyl-2-adamantyl) 4-(4-ethenyl-2,3,5,6-tetrafluoroanilino)benzoate |
|---|---|
| PubChem CID | 167269615 |
| Molecular Formula | C26H25F4NO2 |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (2-methyl-2-adamantyl) 4-(4-ethenyl-2,3,5,6-tetrafluoroanilino)benzoate |
| SMILES | C=Cc1c(F)c(F)c(Nc2ccc(C(=O)OC3(C)C4CC5CC(C4)CC3C5)cc2)c(F)c1F |
| InChI | InChI=1S/C26H25F4NO2/c1-3-19-20(27)22(29)24(23(30)21(19)28)31-18-6-4-15(5-7-18)25(32)33-26(2)16-9-13-8-14(11-16)12-17(26)10-13/h3-7,13-14,16-17,31H,1,8-12H2,2H3 |
| InChIKey | JLUBFQJGPTYONY-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|