C10H14N4S — CID 167274409
N-(3H-benzimidazol-5-yl)-N'-methylsulfanylethane-1,2-diamine (PubChem CID 167274409) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is N-(3H-benzimidazol-5-yl)-N'-methylsulfanylethane-1,2-diamine.
| Compound Name | N-(3H-benzimidazol-5-yl)-N'-methylsulfanylethane-1,2-diamine |
|---|---|
| PubChem CID | 167274409 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | N-(3H-benzimidazol-5-yl)-N'-methylsulfanylethane-1,2-diamine |
| SMILES | CSNCCNc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C10H14N4S/c1-15-14-5-4-11-8-2-3-9-10(6-8)13-7-12-9/h2-3,6-7,11,14H,4-5H2,1H3,(H,12,13) |
| InChIKey | HPJQISMDGQNPDH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|