C17H25N3 — CID 167274416
2-(3,7-dimethylcyclononyl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 167274416) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 2-(3,7-dimethylcyclononyl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-(3,7-dimethylcyclononyl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 167274416 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 2-(3,7-dimethylcyclononyl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CC1CCCC(C)CC(c2nc3ccccn3n2)CC1 |
| InChI | InChI=1S/C17H25N3/c1-13-6-5-7-14(2)12-15(10-9-13)17-18-16-8-3-4-11-20(16)19-17/h3-4,8,11,13-15H,5-7,9-10,12H2,1-2H3 |
| InChIKey | JTZIJTBPHPKDCF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |