C27H27Cl2N3O4 — CID 167283360
(2R,11E,13S)-6,7-dichloro-13-ethyl-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-17-hydroxy-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione (PubChem CID 167283360) has the molecular formula C27H27Cl2N3O4 and a molecular weight of 528.44 g/mol. Its IUPAC name is (2R,11E,13S)-6,7-dichloro-13-ethyl-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-17-hydroxy-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione.
| Compound Name | (2R,11E,13S)-6,7-dichloro-13-ethyl-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-17-hydroxy-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
|---|---|
| PubChem CID | 167283360 |
| Molecular Formula | C27H27Cl2N3O4 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | (2R,11E,13S)-6,7-dichloro-13-ethyl-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-17-hydroxy-9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3(8),4,6,11,16,19-hexaene-15,18-dione |
| SMILES | C=C(/C=C\C=C/C)[C@@H]1c2ccc(Cl)c(Cl)c2OC/C=C/[C@H](CC)N2CN1n1ccc(=O)c(O)c1C2=O |
| InChI | InChI=1S/C27H27Cl2N3O4/c1-4-6-7-9-17(3)23-19-11-12-20(28)22(29)26(19)36-15-8-10-18(5-2)30-16-32(23)31-14-13-21(33)25(34)24(31)27(30)35/h4,6-14,18,23,34H,3,5,15-16H2,1-2H3/b6-4-,9-7-,10-8+/t18-,23+/m0/s1 |
| InChIKey | LZSACGZGLCQIGB-NXGNDUPGSA-N |
| XLogP | 5.37 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|