C25H22N2O2 — CID 167289176
benzyl 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethylimidazo[1,5-a]quinoline-1-carboxylate (PubChem CID 167289176) has the molecular formula C25H22N2O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is benzyl 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethylimidazo[1,5-a]quinoline-1-carboxylate.
| Compound Name | benzyl 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethylimidazo[1,5-a]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 167289176 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | benzyl 5-[(1Z)-buta-1,3-dienyl]-3,4-dimethylimidazo[1,5-a]quinoline-1-carboxylate |
| SMILES | C=C/C=C\c1c(C)c2c(C)nc(C(=O)OCc3ccccc3)n2c2ccccc12 |
| InChI | InChI=1S/C25H22N2O2/c1-4-5-13-20-17(2)23-18(3)26-24(27(23)22-15-10-9-14-21(20)22)25(28)29-16-19-11-7-6-8-12-19/h4-15H,1,16H2,2-3H3/b13-5- |
| InChIKey | WKOORUDGQDGWNW-ACAGNQJTSA-N |
| XLogP | 5.66 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|