C36H39N7O5 — CID 167289924
4-(2-methylprop-2-enoyloxy)butyl 4-[[4-[2-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]hydrazinyl]-2-methylphenyl]diazenyl]-3-hydroxybenzoate (PubChem CID 167289924) has the molecular formula C36H39N7O5 and a molecular weight of 649.75 g/mol. Its IUPAC name is 4-(2-methylprop-2-enoyloxy)butyl 4-[[4-[2-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]hydrazinyl]-2-methylphenyl]diazenyl]-3-hydroxybenzoate.
| Compound Name | 4-(2-methylprop-2-enoyloxy)butyl 4-[[4-[2-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]hydrazinyl]-2-methylphenyl]diazenyl]-3-hydroxybenzoate |
|---|---|
| PubChem CID | 167289924 |
| Molecular Formula | C36H39N7O5 |
| Molecular Weight | 649.75 g/mol |
| Exact Mass | 649.30 |
| IUPAC Name | 4-(2-methylprop-2-enoyloxy)butyl 4-[[4-[2-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]hydrazinyl]-2-methylphenyl]diazenyl]-3-hydroxybenzoate |
| SMILES | C=C(C)C(=O)OCCCCOC(=O)c1ccc(/N=N/c2ccc(NNc3ccc(/N=N/c4ccc(N(C)C)cc4)cc3)cc2C)c(O)c1 |
| InChI | InChI=1S/C36H39N7O5/c1-24(2)35(45)47-20-6-7-21-48-36(46)26-8-18-33(34(44)23-26)42-41-32-19-15-30(22-25(32)3)40-39-28-11-9-27(10-12-28)37-38-29-13-16-31(17-14-29)43(4)5/h8-19,22-23,39-40,44H,1,6-7,20-21H2,2-5H3/b38-37+,42-41+ |
| InChIKey | LUBSHFIHVXSKSH-LEZRBQDZSA-N |
| XLogP | 9.09 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.75 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|