C16H26N2 — CID 167290576
1-tert-butyl-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]piperazine (PubChem CID 167290576) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1-tert-butyl-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]piperazine.
| Compound Name | 1-tert-butyl-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]piperazine |
|---|---|
| PubChem CID | 167290576 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1-tert-butyl-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]piperazine |
| SMILES | C=C/C=C\C(=C/C=C)N1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H26N2/c1-6-8-10-15(9-7-2)17-11-13-18(14-12-17)16(3,4)5/h6-10H,1-2,11-14H2,3-5H3/b10-8-,15-9+ |
| InChIKey | CDEOQKCSSCXVAL-MNSIHRJDSA-N |
| XLogP | 3.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|