C26H27F4N7O2 — CID 167291316
N-[[3-[4-[[(3S)-3-fluoro-1-methylpiperidin-4-ylidene]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,5-dimethylpyrrole-3-carboxamide (PubChem CID 167291316) has the molecular formula C26H27F4N7O2 and a molecular weight of 545.54 g/mol. Its IUPAC name is N-[[3-[4-[[(3S)-3-fluoro-1-methylpiperidin-4-ylidene]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,5-dimethylpyrrole-3-carboxamide.
| Compound Name | N-[[3-[4-[[(3S)-3-fluoro-1-methylpiperidin-4-ylidene]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 167291316 |
| Molecular Formula | C26H27F4N7O2 |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | N-[[3-[4-[[(3S)-3-fluoro-1-methylpiperidin-4-ylidene]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,5-dimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2nc(-c3cc4c(/N=C5/CCN(C)C[C@@H]5F)cccc4n3CC(F)(F)F)no2)cn1C |
| InChI | InChI=1S/C26H27F4N7O2/c1-15-9-16(12-36(15)3)25(38)31-11-23-33-24(34-39-23)22-10-17-19(32-20-7-8-35(2)13-18(20)27)5-4-6-21(17)37(22)14-26(28,29)30/h4-6,9-10,12,18H,7-8,11,13-14H2,1-3H3,(H,31,38)/b32-20-/t18-/m0/s1 |
| InChIKey | HOHZEOKWBGGUQR-GUZDFVJPSA-N |
| XLogP | 4.58 |
| TPSA | 93.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|