C43H85NO3 — CID 167295362
N-[4-(5-hexyl-2,5-dimethyldodec-3-en-2-yl)oxy-2-methylbutan-2-yl]-2-(8-methylpentadecan-8-yloxy)acetamide (PubChem CID 167295362) has the molecular formula C43H85NO3 and a molecular weight of 664.16 g/mol. Its IUPAC name is N-[4-(5-hexyl-2,5-dimethyldodec-3-en-2-yl)oxy-2-methylbutan-2-yl]-2-(8-methylpentadecan-8-yloxy)acetamide.
| Compound Name | N-[4-(5-hexyl-2,5-dimethyldodec-3-en-2-yl)oxy-2-methylbutan-2-yl]-2-(8-methylpentadecan-8-yloxy)acetamide |
|---|---|
| PubChem CID | 167295362 |
| Molecular Formula | C43H85NO3 |
| Molecular Weight | 664.16 g/mol |
| Exact Mass | 663.65 |
| IUPAC Name | N-[4-(5-hexyl-2,5-dimethyldodec-3-en-2-yl)oxy-2-methylbutan-2-yl]-2-(8-methylpentadecan-8-yloxy)acetamide |
| SMILES | CCCCCCCC(C)(C=CC(C)(C)OCCC(C)(C)NC(=O)COC(C)(CCCCCCC)CCCCCCC)CCCCCC |
| InChI | InChI=1S/C43H85NO3/c1-11-15-19-23-27-31-42(9,30-26-22-18-14-4)35-34-41(7,8)46-37-36-40(5,6)44-39(45)38-47-43(10,32-28-24-20-16-12-2)33-29-25-21-17-13-3/h34-35H,11-33,36-38H2,1-10H3,(H,44,45) |
| InChIKey | FDSXKDSGCUKJRT-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.16 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|