C35H71N3O4 — CID 170265457
N-[2-amino-2,4,4-trimethyl-5-[[2-(6-methyldodecan-6-yloxy)acetyl]amino]pentyl]-2-(5-methylnonan-5-yloxy)acetamide (PubChem CID 170265457) has the molecular formula C35H71N3O4 and a molecular weight of 597.97 g/mol. Its IUPAC name is N-[2-amino-2,4,4-trimethyl-5-[[2-(6-methyldodecan-6-yloxy)acetyl]amino]pentyl]-2-(5-methylnonan-5-yloxy)acetamide.
| Compound Name | N-[2-amino-2,4,4-trimethyl-5-[[2-(6-methyldodecan-6-yloxy)acetyl]amino]pentyl]-2-(5-methylnonan-5-yloxy)acetamide |
|---|---|
| PubChem CID | 170265457 |
| Molecular Formula | C35H71N3O4 |
| Molecular Weight | 597.97 g/mol |
| Exact Mass | 597.54 |
| IUPAC Name | N-[2-amino-2,4,4-trimethyl-5-[[2-(6-methyldodecan-6-yloxy)acetyl]amino]pentyl]-2-(5-methylnonan-5-yloxy)acetamide |
| SMILES | CCCCCCC(C)(CCCCC)OCC(=O)NCC(C)(C)CC(C)(N)CNC(=O)COC(C)(CCCC)CCCC |
| InChI | InChI=1S/C35H71N3O4/c1-10-14-18-20-24-35(9,23-19-15-11-2)42-25-30(39)37-28-32(5,6)27-33(7,36)29-38-31(40)26-41-34(8,21-16-12-3)22-17-13-4/h10-29,36H2,1-9H3,(H,37,39)(H,38,40) |
| InChIKey | DGIPWYQLLFJMNO-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.97 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|