C17H20FN3 — CID 167297262
(5S)-7-ethenyl-2-(2-fluorobutan-2-yl)-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 167297262) has the molecular formula C17H20FN3 and a molecular weight of 285.37 g/mol. Its IUPAC name is (5S)-7-ethenyl-2-(2-fluorobutan-2-yl)-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S)-7-ethenyl-2-(2-fluorobutan-2-yl)-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 167297262 |
| Molecular Formula | C17H20FN3 |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (5S)-7-ethenyl-2-(2-fluorobutan-2-yl)-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | C=CC1C[C@@H](c2ccccc2)n2nc(C(C)(F)CC)nc21 |
| InChI | InChI=1S/C17H20FN3/c1-4-12-11-14(13-9-7-6-8-10-13)21-15(12)19-16(20-21)17(3,18)5-2/h4,6-10,12,14H,1,5,11H2,2-3H3/t12?,14-,17?/m0/s1 |
| InChIKey | ZZGRWWIAOZHVGV-TVIZTDCDSA-N |
| XLogP | 4.14 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|