C17H24N4 — CID 82566161
(2-tert-butyl-5-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)methanamine (PubChem CID 82566161) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is (2-tert-butyl-5-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)methanamine.
| Compound Name | (2-tert-butyl-5-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)methanamine |
|---|---|
| PubChem CID | 82566161 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (2-tert-butyl-5-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)methanamine |
| SMILES | CC(C)(C)c1nc2n(n1)C(c1ccccc1)CCC2CN |
| InChI | InChI=1S/C17H24N4/c1-17(2,3)16-19-15-13(11-18)9-10-14(21(15)20-16)12-7-5-4-6-8-12/h4-8,13-14H,9-11,18H2,1-3H3 |
| InChIKey | IOZRUHNRQQAIJM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |