About 7-[[2-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]amino]-4-methyl-1,4-benzoxazin-3-one
7-[[2-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]amino]-4-methyl-1,4-benzoxazin-3-one (PubChem CID 167300301) has the molecular formula C24H26N4O3
and a molecular weight of 418.50 g/mol. Its IUPAC name is 7-[[2-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]amino]-4-methyl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 7-[[2-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]amino]-4-methyl-1,4-benzoxazin-3-one |
| PubChem CID | 167300301 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 7-[[2-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]amino]-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CC1CN(c2ccc3cc(Nc4ccc5c(c4)OCC(=O)N5C)ccc3n2)CC(C)O1 |
| InChI | InChI=1S/C24H26N4O3/c1-15-12-28(13-16(2)31-15)23-9-4-17-10-18(5-7-20(17)26-23)25-19-6-8-21-22(11-19)30-14-24(29)27(21)3/h4-11,15-16,25H,12-14H2,1-3H3 |
| InChIKey | NBJJISBTAUDSEK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[[2-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]amino]-4-methyl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[2-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]amino]-4-methyl-1,4-benzoxazin-3-one?
The IUPAC name of 7-[[2-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]amino]-4-methyl-1,4-benzoxazin-3-one (CID 167300301) is 7-[[2-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]amino]-4-methyl-1,4-benzoxazin-3-one.
What is the SMILES notation for 7-[[2-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]amino]-4-methyl-1,4-benzoxazin-3-one?
The canonical SMILES for 7-[[2-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]amino]-4-methyl-1,4-benzoxazin-3-one is CC1CN(c2ccc3cc(Nc4ccc5c(c4)OCC(=O)N5C)ccc3n2)CC(C)O1.
What is the InChIKey of 7-[[2-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]amino]-4-methyl-1,4-benzoxazin-3-one?
The InChIKey is NBJJISBTAUDSEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N4O3/c1-15-12-28(13-16(2)31-15)23-9-4-17-10-18(5-7-20(17)26-23)25-19-6-8-21-22(11-19)30-14-24(29)27(21)3/h4-11,15-16,25H,12-14H2,1-3H3.
What are the key properties of 7-[[2-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]amino]-4-methyl-1,4-benzoxazin-3-one?
7-[[2-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]amino]-4-methyl-1,4-benzoxazin-3-one has a molecular weight of 418.50 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[2-(2,6-dimethylmorpholin-4-yl)quinolin-6-yl]amino]-4-methyl-1,4-benzoxazin-3-one is sourced from PubChem (CID 167300301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).