C24H32N4O3 — CID 167299882
7-[4-(2,6-dimethylmorpholin-4-yl)-3-methylanilino]-4-[2-(methylamino)ethyl]-1,4-benzoxazin-3-one (PubChem CID 167299882) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is 7-[4-(2,6-dimethylmorpholin-4-yl)-3-methylanilino]-4-[2-(methylamino)ethyl]-1,4-benzoxazin-3-one.
| Compound Name | 7-[4-(2,6-dimethylmorpholin-4-yl)-3-methylanilino]-4-[2-(methylamino)ethyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 167299882 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 7-[4-(2,6-dimethylmorpholin-4-yl)-3-methylanilino]-4-[2-(methylamino)ethyl]-1,4-benzoxazin-3-one |
| SMILES | CNCCN1C(=O)COc2cc(Nc3ccc(N4CC(C)OC(C)C4)c(C)c3)ccc21 |
| InChI | InChI=1S/C24H32N4O3/c1-16-11-19(5-7-21(16)27-13-17(2)31-18(3)14-27)26-20-6-8-22-23(12-20)30-15-24(29)28(22)10-9-25-4/h5-8,11-12,17-18,25-26H,9-10,13-15H2,1-4H3 |
| InChIKey | YITBKXDIZDMXQQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|