C16H12ClF4N3O2S — CID 16730167
5-(4-chlorophenyl)sulfonyl-4,6-bis(2,2-difluoroethenyl)-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine (PubChem CID 16730167) has the molecular formula C16H12ClF4N3O2S and a molecular weight of 421.80 g/mol. Its IUPAC name is 5-(4-chlorophenyl)sulfonyl-4,6-bis(2,2-difluoroethenyl)-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine.
| Compound Name | 5-(4-chlorophenyl)sulfonyl-4,6-bis(2,2-difluoroethenyl)-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 16730167 |
| Molecular Formula | C16H12ClF4N3O2S |
| Molecular Weight | 421.80 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 5-(4-chlorophenyl)sulfonyl-4,6-bis(2,2-difluoroethenyl)-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1C(C=C(F)F)Cc2[nH]ncc2C1C=C(F)F |
| InChI | InChI=1S/C16H12ClF4N3O2S/c17-9-1-3-11(4-2-9)27(25,26)24-10(6-15(18)19)5-13-12(8-22-23-13)14(24)7-16(20)21/h1-4,6-8,10,14H,5H2,(H,22,23) |
| InChIKey | VQICZUMHISWBRF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |