C8H13N2OP — CID 167302927
2-dimethylphosphanyloxybenzene-1,4-diamine (PubChem CID 167302927) has the molecular formula C8H13N2OP and a molecular weight of 184.18 g/mol. Its IUPAC name is 2-dimethylphosphanyloxybenzene-1,4-diamine.
| Compound Name | 2-dimethylphosphanyloxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 167302927 |
| Molecular Formula | C8H13N2OP |
| Molecular Weight | 184.18 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-dimethylphosphanyloxybenzene-1,4-diamine |
| SMILES | CP(C)Oc1cc(N)ccc1N |
| InChI | InChI=1S/C8H13N2OP/c1-12(2)11-8-5-6(9)3-4-7(8)10/h3-5H,9-10H2,1-2H3 |
| InChIKey | ZMBRYSBREUERHM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.18 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|