C8H12N2O3 — CID 144827067
1-(2,5-diaminophenoxy)ethane-1,2-diol (PubChem CID 144827067) has the molecular formula C8H12N2O3 and a molecular weight of 184.20 g/mol. Its IUPAC name is 1-(2,5-diaminophenoxy)ethane-1,2-diol.
| Compound Name | 1-(2,5-diaminophenoxy)ethane-1,2-diol |
|---|---|
| PubChem CID | 144827067 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 1-(2,5-diaminophenoxy)ethane-1,2-diol |
| SMILES | Nc1ccc(N)c(OC(O)CO)c1 |
| InChI | InChI=1S/C8H12N2O3/c9-5-1-2-6(10)7(3-5)13-8(12)4-11/h1-3,8,11-12H,4,9-10H2 |
| InChIKey | UDIORXXYWBUABB-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|