C9H12FNO3 — CID 117095564
2-(2-amino-5-fluorophenoxy)propane-1,3-diol (PubChem CID 117095564) has the molecular formula C9H12FNO3 and a molecular weight of 201.20 g/mol. Its IUPAC name is 2-(2-amino-5-fluorophenoxy)propane-1,3-diol.
| Compound Name | 2-(2-amino-5-fluorophenoxy)propane-1,3-diol |
|---|---|
| PubChem CID | 117095564 |
| Molecular Formula | C9H12FNO3 |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 2-(2-amino-5-fluorophenoxy)propane-1,3-diol |
| SMILES | Nc1ccc(F)cc1OC(CO)CO |
| InChI | InChI=1S/C9H12FNO3/c10-6-1-2-8(11)9(3-6)14-7(4-12)5-13/h1-3,7,12-13H,4-5,11H2 |
| InChIKey | AFJWWOYHSHCPBL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|