C9H10F3NO — CID 58413286
2-(1,3-difluoropropan-2-yloxy)-4-fluoroaniline (PubChem CID 58413286) has the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. Its IUPAC name is 2-(1,3-difluoropropan-2-yloxy)-4-fluoroaniline.
| Compound Name | 2-(1,3-difluoropropan-2-yloxy)-4-fluoroaniline |
|---|---|
| PubChem CID | 58413286 |
| Molecular Formula | C9H10F3NO |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-(1,3-difluoropropan-2-yloxy)-4-fluoroaniline |
| SMILES | Nc1ccc(F)cc1OC(CF)CF |
| InChI | InChI=1S/C9H10F3NO/c10-4-7(5-11)14-9-3-6(12)1-2-8(9)13/h1-3,7H,4-5,13H2 |
| InChIKey | NIKAWMCRSFNKFW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|