C13H12F7NO2 — CID 162053244
(2R)-2-(2-amino-5-fluorophenoxy)-6,6,6-trifluoro-5-(trifluoromethyl)hexan-3-one (PubChem CID 162053244) has the molecular formula C13H12F7NO2 and a molecular weight of 347.23 g/mol. Its IUPAC name is (2R)-2-(2-amino-5-fluorophenoxy)-6,6,6-trifluoro-5-(trifluoromethyl)hexan-3-one.
| Compound Name | (2R)-2-(2-amino-5-fluorophenoxy)-6,6,6-trifluoro-5-(trifluoromethyl)hexan-3-one |
|---|---|
| PubChem CID | 162053244 |
| Molecular Formula | C13H12F7NO2 |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (2R)-2-(2-amino-5-fluorophenoxy)-6,6,6-trifluoro-5-(trifluoromethyl)hexan-3-one |
| SMILES | C[C@@H](Oc1cc(F)ccc1N)C(=O)CC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H12F7NO2/c1-6(23-10-4-7(14)2-3-8(10)21)9(22)5-11(12(15,16)17)13(18,19)20/h2-4,6,11H,5,21H2,1H3/t6-/m1/s1 |
| InChIKey | YYVFAPBKVHBHQG-ZCFIWIBFSA-N |
| XLogP | 3.88 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|