About (2-amino-5-fluorophenyl) 2-hydroxyacetate
(2-amino-5-fluorophenyl) 2-hydroxyacetate (PubChem CID 117095582) has the molecular formula C8H8FNO3
and a molecular weight of 185.15 g/mol. Its IUPAC name is (2-amino-5-fluorophenyl) 2-hydroxyacetate.
Molecular Properties
| Compound Name | (2-amino-5-fluorophenyl) 2-hydroxyacetate |
| PubChem CID | 117095582 |
| Molecular Formula | C8H8FNO3 |
| Molecular Weight | 185.15 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | (2-amino-5-fluorophenyl) 2-hydroxyacetate |
| SMILES | Nc1ccc(F)cc1OC(=O)CO |
| InChI | InChI=1S/C8H8FNO3/c9-5-1-2-6(10)7(3-5)13-8(12)4-11/h1-3,11H,4,10H2 |
| InChIKey | UOCJDPSKVCYPEU-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.15 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-5-fluorophenyl) 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-5-fluorophenyl) 2-hydroxyacetate?
The IUPAC name of (2-amino-5-fluorophenyl) 2-hydroxyacetate (CID 117095582) is (2-amino-5-fluorophenyl) 2-hydroxyacetate.
What is the SMILES notation for (2-amino-5-fluorophenyl) 2-hydroxyacetate?
The canonical SMILES for (2-amino-5-fluorophenyl) 2-hydroxyacetate is Nc1ccc(F)cc1OC(=O)CO.
What is the InChIKey of (2-amino-5-fluorophenyl) 2-hydroxyacetate?
The InChIKey is UOCJDPSKVCYPEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FNO3/c9-5-1-2-6(10)7(3-5)13-8(12)4-11/h1-3,11H,4,10H2.
What are the key properties of (2-amino-5-fluorophenyl) 2-hydroxyacetate?
(2-amino-5-fluorophenyl) 2-hydroxyacetate has a molecular weight of 185.15 g/mol, XLogP of 0.31, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-5-fluorophenyl) 2-hydroxyacetate is sourced from PubChem (CID 117095582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).