C12H13F4NO2 — CID 153210712
(2R)-2-(2-amino-5-fluorophenoxy)-6,6,6-trifluorohexan-3-one (PubChem CID 153210712) has the molecular formula C12H13F4NO2 and a molecular weight of 279.23 g/mol. Its IUPAC name is (2R)-2-(2-amino-5-fluorophenoxy)-6,6,6-trifluorohexan-3-one.
| Compound Name | (2R)-2-(2-amino-5-fluorophenoxy)-6,6,6-trifluorohexan-3-one |
|---|---|
| PubChem CID | 153210712 |
| Molecular Formula | C12H13F4NO2 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (2R)-2-(2-amino-5-fluorophenoxy)-6,6,6-trifluorohexan-3-one |
| SMILES | C[C@@H](Oc1cc(F)ccc1N)C(=O)CCC(F)(F)F |
| InChI | InChI=1S/C12H13F4NO2/c1-7(10(18)4-5-12(14,15)16)19-11-6-8(13)2-3-9(11)17/h2-3,6-7H,4-5,17H2,1H3/t7-/m1/s1 |
| InChIKey | WLSVDFCKZKSJSI-SSDOTTSWSA-N |
| XLogP | 3.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|