C27H33N3O5 — CID 167303098
3-[6-[(1R,2R)-2-[3-(3,6-dihydro-2H-pyran-4-yl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167303098) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is 3-[6-[(1R,2R)-2-[3-(3,6-dihydro-2H-pyran-4-yl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(1R,2R)-2-[3-(3,6-dihydro-2H-pyran-4-yl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167303098 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 3-[6-[(1R,2R)-2-[3-(3,6-dihydro-2H-pyran-4-yl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@@H]4CCCC[C@H]4N4CC(C5=CCOCC5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H33N3O5/c31-25-8-7-23(26(32)28-25)30-16-18-13-20(5-6-21(18)27(30)33)35-24-4-2-1-3-22(24)29-14-19(15-29)17-9-11-34-12-10-17/h5-6,9,13,19,22-24H,1-4,7-8,10-12,14-16H2,(H,28,31,32)/t22-,23?,24-/m1/s1 |
| InChIKey | XGOOTLPRCLYNAG-NZNOWSIYSA-N |
| XLogP | 2.42 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|