C26H31N3O5 — CID 167303241
3-[6-[(1R,2S)-2-[3-(2,5-dihydrofuran-3-yl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167303241) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is 3-[6-[(1R,2S)-2-[3-(2,5-dihydrofuran-3-yl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(1R,2S)-2-[3-(2,5-dihydrofuran-3-yl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167303241 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 3-[6-[(1R,2S)-2-[3-(2,5-dihydrofuran-3-yl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@@H]4CCCC[C@@H]4N4CC(C5=CCOC5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H31N3O5/c30-24-8-7-22(25(31)27-24)29-14-17-11-19(5-6-20(17)26(29)32)34-23-4-2-1-3-21(23)28-12-18(13-28)16-9-10-33-15-16/h5-6,9,11,18,21-23H,1-4,7-8,10,12-15H2,(H,27,30,31)/t21-,22?,23+/m0/s1 |
| InChIKey | RPPANVBDFDBNKJ-OCESARCHSA-N |
| XLogP | 2.03 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|