C15H24N2O7S3 — CID 167303607
1-(dimethylsulfamoyl)-4-[(2-methylsulfonyloxycyclohexyl)-sulfinoamino]benzene (PubChem CID 167303607) has the molecular formula C15H24N2O7S3 and a molecular weight of 440.57 g/mol. Its IUPAC name is 1-(dimethylsulfamoyl)-4-[(2-methylsulfonyloxycyclohexyl)-sulfinoamino]benzene.
| Compound Name | 1-(dimethylsulfamoyl)-4-[(2-methylsulfonyloxycyclohexyl)-sulfinoamino]benzene |
|---|---|
| PubChem CID | 167303607 |
| Molecular Formula | C15H24N2O7S3 |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 1-(dimethylsulfamoyl)-4-[(2-methylsulfonyloxycyclohexyl)-sulfinoamino]benzene |
| SMILES | CN(C)S(=O)(=O)c1ccc(N(C2CCCCC2OS(C)(=O)=O)S(=O)O)cc1 |
| InChI | InChI=1S/C15H24N2O7S3/c1-16(2)27(22,23)13-10-8-12(9-11-13)17(25(18)19)14-6-4-5-7-15(14)24-26(3,20)21/h8-11,14-15H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | DNKQHHYJIFDAJJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|