C23H45BO2Sn — CID 167311332
tributyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]stannane (PubChem CID 167311332) has the molecular formula C23H45BO2Sn and a molecular weight of 483.13 g/mol. Its IUPAC name is tributyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]stannane.
| Compound Name | tributyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]stannane |
|---|---|
| PubChem CID | 167311332 |
| Molecular Formula | C23H45BO2Sn |
| Molecular Weight | 483.13 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | tributyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C12CC(B3OC(C)(C)C(C)(C)O3)(C1)C2 |
| InChI | InChI=1S/C11H18BO2.3C4H9.Sn/c1-9(2)10(3,4)14-12(13-9)11-5-8(6-11)7-11;3*1-3-4-2;/h5-7H2,1-4H3;3*1,3-4H2,2H3; |
| InChIKey | MVZFXDRFIZTPIH-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.13 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|