C21H40Sn — CID 71382304
tributyl-(1-butylcyclopenta-2,4-dien-1-yl)stannane (PubChem CID 71382304) has the molecular formula C21H40Sn and a molecular weight of 411.26 g/mol. Its IUPAC name is tributyl-(1-butylcyclopenta-2,4-dien-1-yl)stannane.
| Compound Name | tributyl-(1-butylcyclopenta-2,4-dien-1-yl)stannane |
|---|---|
| PubChem CID | 71382304 |
| Molecular Formula | C21H40Sn |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | tributyl-(1-butylcyclopenta-2,4-dien-1-yl)stannane |
| SMILES | CCCCC1([Sn](CCCC)(CCCC)CCCC)C=CC=C1 |
| InChI | InChI=1S/C9H13.3C4H9.Sn/c1-2-3-6-9-7-4-5-8-9;3*1-3-4-2;/h4-5,7-8H,2-3,6H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | AEVPTXIZPVPWME-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |