C39H47N3O21 — CID 167312785
(4-nitrophenyl) 2-[2-[2-[2,3-bis[2-[2-[2-(4-nitrophenoxy)-2-oxoethoxy]ethoxy]ethoxy]propoxy]ethoxy]ethoxy]acetate (PubChem CID 167312785) has the molecular formula C39H47N3O21 and a molecular weight of 893.80 g/mol. Its IUPAC name is (4-nitrophenyl) 2-[2-[2-[2,3-bis[2-[2-[2-(4-nitrophenoxy)-2-oxoethoxy]ethoxy]ethoxy]propoxy]ethoxy]ethoxy]acetate.
| Compound Name | (4-nitrophenyl) 2-[2-[2-[2,3-bis[2-[2-[2-(4-nitrophenoxy)-2-oxoethoxy]ethoxy]ethoxy]propoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 167312785 |
| Molecular Formula | C39H47N3O21 |
| Molecular Weight | 893.80 g/mol |
| Exact Mass | 893.27 |
| IUPAC Name | (4-nitrophenyl) 2-[2-[2-[2,3-bis[2-[2-[2-(4-nitrophenoxy)-2-oxoethoxy]ethoxy]ethoxy]propoxy]ethoxy]ethoxy]acetate |
| SMILES | O=C(COCCOCCOCC(COCCOCCOCC(=O)Oc1ccc([N+](=O)[O-])cc1)OCCOCCOCC(=O)Oc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C39H47N3O21/c43-37(61-33-7-1-30(2-8-33)40(46)47)27-57-20-15-52-13-18-55-25-36(60-24-23-54-17-22-59-29-39(45)63-35-11-5-32(6-12-35)42(50)51)26-56-19-14-53-16-21-58-28-38(44)62-34-9-3-31(4-10-34)41(48)49/h1-12,36H,13-29H2 |
| InChIKey | WJUCWQLSQMJFGF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 291.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.80 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|