C18H19N2+ — CID 16731574
2-(1,1-dibenzylaziridin-1-ium-2-yl)acetonitrile (PubChem CID 16731574) has the molecular formula C18H19N2+ and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-(1,1-dibenzylaziridin-1-ium-2-yl)acetonitrile.
| Compound Name | 2-(1,1-dibenzylaziridin-1-ium-2-yl)acetonitrile |
|---|---|
| PubChem CID | 16731574 |
| Molecular Formula | C18H19N2+ |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-(1,1-dibenzylaziridin-1-ium-2-yl)acetonitrile |
| SMILES | N#CCC1C[N+]1(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H19N2/c19-12-11-18-15-20(18,13-16-7-3-1-4-8-16)14-17-9-5-2-6-10-17/h1-10,18H,11,13-15H2/q+1 |
| InChIKey | VQQITGXLMKSXCU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|