C12H15F2NO — CID 102468922
(3R,5R)-1-benzyl-3,5-difluoro-1-oxidopiperidin-1-ium (PubChem CID 102468922) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is (3R,5R)-1-benzyl-3,5-difluoro-1-oxidopiperidin-1-ium.
| Compound Name | (3R,5R)-1-benzyl-3,5-difluoro-1-oxidopiperidin-1-ium |
|---|---|
| PubChem CID | 102468922 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (3R,5R)-1-benzyl-3,5-difluoro-1-oxidopiperidin-1-ium |
| SMILES | [O-][N+]1(Cc2ccccc2)C[C@H](F)C[C@@H](F)C1 |
| InChI | InChI=1S/C12H15F2NO/c13-11-6-12(14)9-15(16,8-11)7-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2/t11-,12-/m1/s1 |
| InChIKey | GXLXAQFYMNPPPI-VXGBXAGGSA-N |
| XLogP | 2.58 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|