C13H15BrN+ — CID 98090818
(2S,3R,4S,6R)-1-benzyl-3-bromo-1-azoniatricyclo[2.2.1.02,6]heptane (PubChem CID 98090818) has the molecular formula C13H15BrN+ and a molecular weight of 265.17 g/mol. Its IUPAC name is (2S,3R,4S,6R)-1-benzyl-3-bromo-1-azoniatricyclo[2.2.1.02,6]heptane.
| Compound Name | (2S,3R,4S,6R)-1-benzyl-3-bromo-1-azoniatricyclo[2.2.1.02,6]heptane |
|---|---|
| PubChem CID | 98090818 |
| Molecular Formula | C13H15BrN+ |
| Molecular Weight | 265.17 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (2S,3R,4S,6R)-1-benzyl-3-bromo-1-azoniatricyclo[2.2.1.02,6]heptane |
| SMILES | Br[C@@H]1[C@H]2C[C@@H]3[C@@H]1[N+]3(Cc1ccccc1)C2 |
| InChI | InChI=1S/C13H15BrN/c14-12-10-6-11-13(12)15(11,8-10)7-9-4-2-1-3-5-9/h1-5,10-13H,6-8H2/q+1/t10-,11+,12+,13-,15?/m0/s1 |
| InChIKey | XHYJGHLAIHMIPV-VJDSNFAGSA-N |
| XLogP | 2.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|