C32H59N7O5 — CID 167319401
1-(aminomethyl)-15,16-dibutyl-9-cyclohexyl-13,18-dimethyl-12-propyl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone (PubChem CID 167319401) has the molecular formula C32H59N7O5 and a molecular weight of 621.87 g/mol. Its IUPAC name is 1-(aminomethyl)-15,16-dibutyl-9-cyclohexyl-13,18-dimethyl-12-propyl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone.
| Compound Name | 1-(aminomethyl)-15,16-dibutyl-9-cyclohexyl-13,18-dimethyl-12-propyl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 167319401 |
| Molecular Formula | C32H59N7O5 |
| Molecular Weight | 621.87 g/mol |
| Exact Mass | 621.46 |
| IUPAC Name | 1-(aminomethyl)-15,16-dibutyl-9-cyclohexyl-13,18-dimethyl-12-propyl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14-pentone |
| SMILES | CCCCC1C(=O)N(C)C(CCC)C(=O)NC(C2CCCCC2)C(=O)NCC(=O)NCC(=O)N(CN)C(C)CN1CCCC |
| InChI | InChI=1S/C32H59N7O5/c1-6-9-17-26-32(44)37(5)25(14-8-3)30(42)36-29(24-15-12-11-13-16-24)31(43)35-19-27(40)34-20-28(41)39(22-33)23(4)21-38(26)18-10-7-2/h23-26,29H,6-22,33H2,1-5H3,(H,34,40)(H,35,43)(H,36,42) |
| InChIKey | PCOKWKBZUCOBMJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.87 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |