C32H37N3O4 — CID 167320712
2-[3-ethylimino-2-methyl-6-(methylamino)xanthen-9-yl]-5-(2,2,3-trimethylbutylcarbamoyl)benzoic acid (PubChem CID 167320712) has the molecular formula C32H37N3O4 and a molecular weight of 527.67 g/mol. Its IUPAC name is 2-[3-ethylimino-2-methyl-6-(methylamino)xanthen-9-yl]-5-(2,2,3-trimethylbutylcarbamoyl)benzoic acid.
| Compound Name | 2-[3-ethylimino-2-methyl-6-(methylamino)xanthen-9-yl]-5-(2,2,3-trimethylbutylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 167320712 |
| Molecular Formula | C32H37N3O4 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | 2-[3-ethylimino-2-methyl-6-(methylamino)xanthen-9-yl]-5-(2,2,3-trimethylbutylcarbamoyl)benzoic acid |
| SMILES | CC/N=c1\cc2oc3cc(NC)ccc3c(-c3ccc(C(=O)NCC(C)(C)C(C)C)cc3C(=O)O)c-2cc1C |
| InChI | InChI=1S/C32H37N3O4/c1-8-34-26-16-28-25(13-19(26)4)29(23-12-10-21(33-7)15-27(23)39-28)22-11-9-20(14-24(22)31(37)38)30(36)35-17-32(5,6)18(2)3/h9-16,18,33H,8,17H2,1-7H3,(H,35,36)(H,37,38)/b34-26+ |
| InChIKey | NUNHVSHAINEGDF-JJNGWGCYSA-N |
| XLogP | 6.59 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|