C26H29I2O+ — CID 167331552
(4-tert-butylphenyl)-[4-[2-(4-iodophenyl)propan-2-yloxy]-2-methylphenyl]iodanium (PubChem CID 167331552) has the molecular formula C26H29I2O+ and a molecular weight of 611.33 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-[2-(4-iodophenyl)propan-2-yloxy]-2-methylphenyl]iodanium.
| Compound Name | (4-tert-butylphenyl)-[4-[2-(4-iodophenyl)propan-2-yloxy]-2-methylphenyl]iodanium |
|---|---|
| PubChem CID | 167331552 |
| Molecular Formula | C26H29I2O+ |
| Molecular Weight | 611.33 g/mol |
| Exact Mass | 611.03 |
| IUPAC Name | (4-tert-butylphenyl)-[4-[2-(4-iodophenyl)propan-2-yloxy]-2-methylphenyl]iodanium |
| SMILES | Cc1cc(OC(C)(C)c2ccc(I)cc2)ccc1[I+]c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H29I2O/c1-18-17-23(29-26(5,6)20-7-11-21(27)12-8-20)15-16-24(18)28-22-13-9-19(10-14-22)25(2,3)4/h7-17H,1-6H3/q+1 |
| InChIKey | GJIHRWAYDHFHAY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|