C23H22I3O2+ — CID 162496495
(4-tert-butylphenyl)-[4-(4-hydroxy-3,5-diiodophenoxy)-2-methylphenyl]iodanium (PubChem CID 162496495) has the molecular formula C23H22I3O2+ and a molecular weight of 711.14 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-(4-hydroxy-3,5-diiodophenoxy)-2-methylphenyl]iodanium.
| Compound Name | (4-tert-butylphenyl)-[4-(4-hydroxy-3,5-diiodophenoxy)-2-methylphenyl]iodanium |
|---|---|
| PubChem CID | 162496495 |
| Molecular Formula | C23H22I3O2+ |
| Molecular Weight | 711.14 g/mol |
| Exact Mass | 710.87 |
| IUPAC Name | (4-tert-butylphenyl)-[4-(4-hydroxy-3,5-diiodophenoxy)-2-methylphenyl]iodanium |
| SMILES | Cc1cc(Oc2cc(I)c(O)c(I)c2)ccc1[I+]c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H21I3O2/c1-14-11-17(28-18-12-19(24)22(27)20(25)13-18)9-10-21(14)26-16-7-5-15(6-8-16)23(2,3)4/h5-13H,1-4H3/p+1 |
| InChIKey | WLOMKVGCVVGCAB-UHFFFAOYSA-O |
| XLogP | 4.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.14 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|