C48H46F3IrN3OSi-2 — CID 167332134
1-(2,6-ditert-butylphenyl)-2-[7-(trifluoromethyl)-3H-dibenzofuran-3-id-4-yl]benzimidazole;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 167332134) has the molecular formula C48H46F3IrN3OSi-2 and a molecular weight of 958.21 g/mol. Its IUPAC name is 1-(2,6-ditert-butylphenyl)-2-[7-(trifluoromethyl)-3H-dibenzofuran-3-id-4-yl]benzimidazole;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | 1-(2,6-ditert-butylphenyl)-2-[7-(trifluoromethyl)-3H-dibenzofuran-3-id-4-yl]benzimidazole;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 167332134 |
| Molecular Formula | C48H46F3IrN3OSi-2 |
| Molecular Weight | 958.21 g/mol |
| Exact Mass | 958.30 |
| IUPAC Name | 1-(2,6-ditert-butylphenyl)-2-[7-(trifluoromethyl)-3H-dibenzofuran-3-id-4-yl]benzimidazole;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc(C(F)(F)F)ccc23)nc2ccccc21.C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C34H30F3N2O.C14H16NSi.Ir/c1-32(2,3)24-13-10-14-25(33(4,5)6)29(24)39-27-16-8-7-15-26(27)38-31(39)23-12-9-11-22-21-18-17-20(34(35,36)37)19-28(21)40-30(22)23;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h7-11,13-19H,1-6H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | GQJKNMJVUJQOOG-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.21 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|