C36H38N4O3 — CID 167335092
(2E)-2-[3-[2-[[4-[3-[4-(diethylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-yl]cyclohexa-2,5-dien-1-yl]-ethylamino]ethoxy]-2,3-dihydroinden-1-ylidene]-2-isocyanoacetonitrile (PubChem CID 167335092) has the molecular formula C36H38N4O3 and a molecular weight of 574.73 g/mol. Its IUPAC name is (2E)-2-[3-[2-[[4-[3-[4-(diethylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-yl]cyclohexa-2,5-dien-1-yl]-ethylamino]ethoxy]-2,3-dihydroinden-1-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[3-[2-[[4-[3-[4-(diethylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-yl]cyclohexa-2,5-dien-1-yl]-ethylamino]ethoxy]-2,3-dihydroinden-1-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 167335092 |
| Molecular Formula | C36H38N4O3 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | (2E)-2-[3-[2-[[4-[3-[4-(diethylamino)phenyl]-2-hydroxy-4-oxocyclobut-2-en-1-yl]cyclohexa-2,5-dien-1-yl]-ethylamino]ethoxy]-2,3-dihydroinden-1-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\CC(OCCN(CC)C2C=CC(C3C(=O)C(c4ccc(N(CC)CC)cc4)=C3O)C=C2)c2ccccc21 |
| InChI | InChI=1S/C36H38N4O3/c1-5-39(6-2)26-16-12-24(13-17-26)33-35(41)34(36(33)42)25-14-18-27(19-15-25)40(7-3)20-21-43-32-22-30(31(23-37)38-4)28-10-8-9-11-29(28)32/h8-19,25,27,32,34,41H,5-7,20-22H2,1-3H3/b31-30+ |
| InChIKey | JAPQAQNATVJXBI-NVQSTNCTSA-N |
| XLogP | 6.75 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|