C6H8N4 — CID 167343650
3-isocyano-1-propan-2-yl-1,2,4-triazole (PubChem CID 167343650) has the molecular formula C6H8N4 and a molecular weight of 136.16 g/mol. Its IUPAC name is 3-isocyano-1-propan-2-yl-1,2,4-triazole.
| Compound Name | 3-isocyano-1-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 167343650 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 3-isocyano-1-propan-2-yl-1,2,4-triazole |
| SMILES | [C-]#[N+]c1ncn(C(C)C)n1 |
| InChI | InChI=1S/C6H8N4/c1-5(2)10-4-8-6(7-3)9-10/h4-5H,1-2H3 |
| InChIKey | NXAZIBNLFVSFQV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 35.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|