C25H22F3N3O4 — CID 167344075
(1R,11S)-6-[2-[4-[3-(trifluoromethyl)phenoxy]phenyl]ethoxy]-12-oxa-3,5,9-triazatetracyclo[9.2.1.01,9.03,8]tetradeca-5,7-dien-4-one (PubChem CID 167344075) has the molecular formula C25H22F3N3O4 and a molecular weight of 485.46 g/mol. Its IUPAC name is (1R,11S)-6-[2-[4-[3-(trifluoromethyl)phenoxy]phenyl]ethoxy]-12-oxa-3,5,9-triazatetracyclo[9.2.1.01,9.03,8]tetradeca-5,7-dien-4-one.
| Compound Name | (1R,11S)-6-[2-[4-[3-(trifluoromethyl)phenoxy]phenyl]ethoxy]-12-oxa-3,5,9-triazatetracyclo[9.2.1.01,9.03,8]tetradeca-5,7-dien-4-one |
|---|---|
| PubChem CID | 167344075 |
| Molecular Formula | C25H22F3N3O4 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | (1R,11S)-6-[2-[4-[3-(trifluoromethyl)phenoxy]phenyl]ethoxy]-12-oxa-3,5,9-triazatetracyclo[9.2.1.01,9.03,8]tetradeca-5,7-dien-4-one |
| SMILES | O=c1nc(OCCc2ccc(Oc3cccc(C(F)(F)F)c3)cc2)cc2n1C[C@]13CO[C@H](CN21)C3 |
| InChI | InChI=1S/C25H22F3N3O4/c26-25(27,28)17-2-1-3-19(10-17)35-18-6-4-16(5-7-18)8-9-33-21-11-22-30(23(32)29-21)14-24-12-20(34-15-24)13-31(22)24/h1-7,10-11,20H,8-9,12-15H2/t20-,24+/m0/s1 |
| InChIKey | HOSJUUBOWKZFMF-GBXCKJPGSA-N |
| XLogP | 4.04 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |