About CID 167346588
CID 167346588 (PubChem CID 167346588) has the molecular formula C5H7O2Si
and a molecular weight of 127.19 g/mol.
Molecular Properties
| Compound Name | CID 167346588 |
| PubChem CID | 167346588 |
| Molecular Formula | C5H7O2Si |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.02 |
| IUPAC Name | — |
| SMILES | CC1C(=O)OCC1[Si] |
| InChI | InChI=1S/C5H7O2Si/c1-3-4(8)2-7-5(3)6/h3-4H,2H2,1H3 |
| InChIKey | KUTYNAONRQVBPF-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 167346588 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167346588?
The IUPAC name of CID 167346588 (CID 167346588) is not available.
What is the SMILES notation for CID 167346588?
The canonical SMILES for CID 167346588 is CC1C(=O)OCC1[Si].
What is the InChIKey of CID 167346588?
The InChIKey is KUTYNAONRQVBPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7O2Si/c1-3-4(8)2-7-5(3)6/h3-4H,2H2,1H3.
What are the key properties of CID 167346588?
CID 167346588 has a molecular weight of 127.19 g/mol, XLogP of 0.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167346588 is sourced from PubChem (CID 167346588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).